CymitQuimica logo

CAS 75896-70-7

:

4,6,7-Trichloro-2-methylquinoline

Description:
4,6,7-Trichloro-2-methylquinoline is a synthetic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of three chlorine atoms at the 4, 6, and 7 positions, along with a methyl group at the 2 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive molecules. The chlorinated nature of the compound may impart specific reactivity, making it useful in chemical reactions such as nucleophilic substitutions. Additionally, 4,6,7-Trichloro-2-methylquinoline may exhibit biological activity, which warrants careful handling and consideration of safety protocols during its use in laboratory settings. As with many chlorinated compounds, it is essential to assess its environmental impact and toxicity.
Formula:C10H6Cl3N
InChI:InChI=1S/C10H6Cl3N/c1-5-2-7(11)6-3-8(12)9(13)4-10(6)14-5/h2-4H,1H3
InChI key:InChIKey=GIUJOEVTMZWXCU-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(Cl)C(Cl)=C2)N=C(C)C1
Synonyms:
  • 2-Methyl-4,6,7-trichloroquinoline
  • 4,6,7-Trichloro-2-methylquinoline
  • Quinoline, 4,6,7-Trichloro-2-Methyl-
Found 1 products.