CAS 759-36-4
:1,3-Diethyl 2-(1-methylethyl)propanedioate
Description:
1,3-Diethyl 2-(1-methylethyl)propanedioate, with the CAS number 759-36-4, is an organic compound belonging to the class of diesters. It features a propanedioate backbone with two ethyl groups attached to the first carbon and a branched isopropyl group on the second carbon. This structure contributes to its unique chemical properties, including its potential as a solvent or intermediate in organic synthesis. The compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its molecular structure allows for various functional group interactions, making it useful in chemical reactions such as esterification and transesterification. Additionally, it may exhibit moderate to low toxicity, necessitating standard safety precautions during handling. As with many organic compounds, its reactivity can be influenced by environmental factors such as temperature and pH. Overall, 1,3-Diethyl 2-(1-methylethyl)propanedioate serves as an interesting subject for further research in organic chemistry and potential applications in various industrial processes.
Formula:C10H18O4
InChI:InChI=1S/C10H18O4/c1-5-13-9(11)8(7(3)4)10(12)14-6-2/h7-8H,5-6H2,1-4H3
InChI key:InChIKey=BYQFBFWERHXONI-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C(OCC)=O)C(C)C
Synonyms:- (1-Methylethyl)propanedioic acid diethyl ester
- 1,3-Diethyl 2-(1-methylethyl)propanedioate
- 1,3-Diethyl 2-(propan-2-yl)propanedioate
- Diethyl 2-(1-methylethyl)propanedioate
- Diethyl 2-isopropylmalonate
- Diethyl Ethyl(Methyl)Propanedioate
- Diethyl Propan-2-Ylpropanedioate
- Diethyl ethylmethylmalonate
- Ethyl isopropylmalonate
- Isopropylmalonic acid diethyl ester
- Malonic acid, isopropyl-, diethyl ester
- NSC 1007
- Propanedioic acid, (1-methylethyl)-, diethyl ester
- Propanedioic acid, 2-(1-methylethyl)-, 1,3-diethyl ester
- See more synonyms
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Diethyl Isopropylmalonate
CAS:Formula:C10H18O4Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:202.25Diethyl 2-isopropylmalonate
CAS:Formula:C10H18O4Purity:98%Color and Shape:LiquidMolecular weight:202.2475Diethyl 2-isopropylmalonate
CAS:Diethyl 2-isopropylmalonateFormula:C10H18O4Purity:>98%Molecular weight:202.251,3-diethyl 2-(propan-2-yl)propanedioate
CAS:Formula:C10H18O4Purity:97%Color and Shape:LiquidMolecular weight:202.25Diethyl Isopropylmalonate
CAS:Diethyl IsopropylmalonateFormula:C10H18O4Purity:98%Molecular weight:202.25Diethyl Isopropylmalonate
CAS:Controlled ProductApplications Diethyl isopropylmalonate (cas# 759-36-4) is a useful research chemical.
Formula:C10H18O4Color and Shape:NeatMolecular weight:202.24





