CymitQuimica logo

CAS 75906-36-4

:

Benzenebutanol, 4-bromo-

Description:
4-Bromobenzenebutanol, with the CAS number 75906-36-4, is an organic compound that features a bromine atom and a butanol group attached to a benzene ring. This compound typically exhibits characteristics common to both aromatic and aliphatic compounds. The presence of the bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions or coupling reactions. The hydroxyl (-OH) group in the butanol portion contributes to its polarity, enhancing its solubility in polar solvents while still allowing for some degree of solubility in non-polar solvents due to the aromatic ring. This compound may also exhibit moderate to low volatility and can participate in hydrogen bonding due to the hydroxyl group. Its applications may span across fields such as pharmaceuticals, agrochemicals, and materials science, where it can serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H13BrO
InChI:InChI=1S/C10H13BrO/c11-10-6-4-9(5-7-10)3-1-2-8-12/h4-7,12H,1-3,8H2
InChI key:NDWAJMWJTWOGFN-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1CCCCO)Br
Found 6 products.