CymitQuimica logo

CAS 75915-38-7

:

N-(2-bromoethyl)-2,2,2-trifluoroacetamide

Description:
N-(2-bromoethyl)-2,2,2-trifluoroacetamide is a chemical compound characterized by its unique structure, which includes a trifluoroacetamide functional group and a bromoethyl substituent. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The trifluoroacetamide moiety contributes to its polar nature, enhancing solubility in polar solvents while potentially limiting solubility in nonpolar environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, its fluorinated structure can impart unique properties, such as increased stability and altered lipophilicity, which can influence its behavior in biological systems. Safety precautions should be taken when handling this compound, as it may pose health risks, including toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C4H5BrF3NO
InChI:InChI=1/C4H5BrF3NO/c5-1-2-9-3(10)4(6,7)8/h1-2H2,(H,9,10)
SMILES:C(CN=C(C(F)(F)F)O)Br
Synonyms:
  • Acetamide, N-(2-bromoethyl)-2,2,2-trifluoro-
Found 2 products.