CymitQuimica logo

CAS 75926-64-6

:

3-Pyridinamine, 6-(4-chlorophenoxy)-

Description:
3-Pyridinamine, 6-(4-chlorophenoxy)-, with the CAS number 75926-64-6, is an organic compound characterized by its pyridine ring structure substituted with an amino group and a 4-chlorophenoxy group. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The 4-chlorophenoxy moiety introduces both hydrophobic characteristics and potential for further chemical interactions, making it a versatile compound in synthetic chemistry. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests that it could interact with various biological targets, although specific biological activity would need to be determined through empirical studies. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.
Formula:C11H9ClN2O
InChI:InChI=1S/C11H9ClN2O/c12-8-1-4-10(5-2-8)15-11-6-3-9(13)7-14-11/h1-7H,13H2
InChI key:POEUJOWYZVKVMS-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1OC2=NC=C(C=C2)N)Cl
Found 5 products.