CymitQuimica logo

CAS 75959-08-9

:

6-Quinolinamine, 8-methoxy-

Description:
6-Quinolinamine, 8-methoxy- is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features an amino group (-NH2) at the 6-position and a methoxy group (-OCH3) at the 8-position of the quinoline ring. Its molecular formula typically includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its functional groups. The presence of the amino group suggests potential basic properties, while the methoxy group can influence its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, its structural features may allow for various synthetic modifications, potentially leading to derivatives with enhanced properties. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and purity. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-13-9-6-8(11)5-7-3-2-4-12-10(7)9/h2-6H,11H2,1H3
InChI key:FOOUDKKEHNADTE-UHFFFAOYSA-N
SMILES:COC1=C2C(=CC(=C1)N)C=CC=N2
Found 5 products.