CymitQuimica logo

CAS 75965-84-3

:

1-Naphthalenecarboxaldehyde, 2,4-dimethoxy-

Description:
1-Naphthalenecarboxaldehyde, 2,4-dimethoxy- is an organic compound characterized by its aromatic structure, which includes a naphthalene ring substituted with a carboxaldehyde group and two methoxy groups at the 2 and 4 positions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its pleasant aromatic odor, making it useful in the fragrance industry. The presence of the aldehyde functional group contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. Additionally, the methoxy groups enhance its solubility in organic solvents and may influence its biological activity. 1-Naphthalenecarboxaldehyde, 2,4-dimethoxy- is often utilized in synthetic organic chemistry as an intermediate in the production of other chemical compounds, including pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C13H12O3
InChI:InChI=1S/C13H12O3/c1-15-12-7-13(16-2)11(8-14)9-5-3-4-6-10(9)12/h3-8H,1-2H3
InChI key:NNQTVZVNHYJOKQ-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C2=CC=CC=C21)C=O)OC
Found 3 products.