CymitQuimica logo

CAS 76006-07-0

:

5-methoxy-1H-pyrazolo[3,4-c]pyridine

Description:
5-Methoxy-1H-pyrazolo[3,4-c]pyridine is a heterocyclic organic compound characterized by its pyrazolo and pyridine rings. This compound features a methoxy group (-OCH3) at the 5-position of the pyrazole ring, which can influence its chemical reactivity and biological activity. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of both nitrogen atoms in the pyrazole and pyridine rings contributes to its potential as a ligand in coordination chemistry and its utility in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various biological activities, including anti-inflammatory or neuroprotective effects, making it of interest in drug discovery. Its molecular structure allows for interactions with biological targets, which can be explored in pharmacological studies. As with many heterocycles, the stability and reactivity of 5-methoxy-1H-pyrazolo[3,4-c]pyridine can be influenced by substituents and the electronic environment of the rings.
Formula:C7H7N3O
InChI:InChI=1/C7H7N3O/c1-11-7-2-5-3-9-10-6(5)4-8-7/h2-4H,1H3,(H,9,10)
InChI key:YLHHBXAFEMTGOY-UHFFFAOYSA-N
SMILES:COc1cc2cn[nH]c2cn1
Found 5 products.