CymitQuimica logo

CAS 76006-14-9

:

3-Chloro-1H-pyrazolo[3,4-c]pyridine

Description:
3-Chloro-1H-pyrazolo[3,4-c]pyridine is a heterocyclic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 3-position of the pyrazole ring enhances its reactivity and potential for substitution reactions. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents. It is often utilized in medicinal chemistry and drug development due to its biological activity, particularly in the context of targeting specific enzymes or receptors. The structure allows for various functionalizations, making it a versatile intermediate in synthetic organic chemistry. Additionally, its stability under standard laboratory conditions makes it suitable for various applications, although care should be taken due to the potential toxicity associated with halogenated compounds. As with any chemical substance, proper handling and safety protocols should be observed to mitigate any risks during its use.
Formula:C6H4ClN3
InChI:InChI=1S/C6H4ClN3/c7-6-4-1-2-8-3-5(4)9-10-6/h1-3H,(H,9,10)
InChI key:InChIKey=AENFQWPNKBSHLK-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CN=CC2)NN1
Synonyms:
  • 1H-Pyrazolo[3,4-c]pyridine, 3-chloro-
  • 3-Chloro-2H-pyrazolo[3,4-c]pyridine
  • 3-Chloro-1H-pyrazolo[3,4-c]pyridine
Found 5 products.