CAS 76076-04-5

β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]

Description:

The chemical substance known as β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate] (CAS number 76076-04-5) is a complex glycoside characterized by its multiple sugar units and phenolic components. This compound features a β-D-glucopyranoside moiety, which is a six-membered cyclic form of glucose, linked to an apiose furanoside and a 6-deoxy-α-L-mannopyranosyl unit. The presence of the 3,4-dihydroxyphenyl group suggests potential antioxidant properties, while the propenoate moiety indicates possible reactivity in various chemical environments. The structural complexity of this compound may contribute to its biological activities, including potential roles in plant defense mechanisms or as a bioactive compound in medicinal chemistry. Its solubility and stability would depend on the specific conditions, such as pH and temperature, making it of interest for further research in pharmacology and biochemistry.

Formula: C₃₄H₄₄O₁₉

InChI: InChI=1S/C34H44O19/c1-15-24(42)28(52-33-30(45)34(46,13-36)14-48-33)25(43)32(49-15)53-29-26(44)31(47-9-8-17-3-6-19(38)21(40)11-17)50-22(12-35)27(29)51-23(41)7-4-16-2-5-18(37)20(39)10-16/h2-7,10-11,15,22,24-33,35-40,42-46H,8-9,12-14H2,1H3

InChI key: InChIKey=KAKUSAKVVYFENV-UHFFFAOYSA-N

SMILES: O(C1C(OC(C=CC2=CC(O)=C(O)C=C2)=O)C(CO)OC(OCCC3=CC(O)=C(O)C=C3)C1O)C4C(O)C(OC5C(O)C(CO)(O)CO5)C(O)C(C)O4

Synonyms:

• Myricoside
• Clerodendroside (Clerodendron myricoides)
• Clerodendroside
• β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
• β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-

Myricoside

CAS: 76076-04-5

Myricoside

Purity: ≥98%

Molecular weight: 756.7g/mol

Ref: 54-BUP05624

Myricoside

CAS: 76076-04-5

Formula: C₃₄H₄₄O₁₉

Purity: 95%~99%

Molecular weight: 756.707

Ref: BP-BP5107

Myricoside

CAS: 76076-04-5

Myricoside (C10479) is a natural product isolated from the aerial parts of Phlomis oppositiflora.

Formula: C₃₄H₄₄O₁₉

Purity: 99.79%

Color and Shape: Solid

Molecular weight: 756.7

Ref: TM-TN7085

Myricoside

CAS: 76076-04-5

Myricoside is a glycoside compound, which is derived from the bark and leaves of the plant _Myrica rubra_, commonly known as the Chinese bayberry. This compound exhibits potential biological activities primarily due to its nature as a plant secondary metabolite with a specific chemical structure that fosters interactions at the cellular level.

Formula: C₃₄H₄₄O₁₉

Purity: Min. 95%

Molecular weight: 756.7 g/mol

Ref: 3D-XM172931