CymitQuimica logo

CAS 76076-04-5

:

β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]

Description:
The chemical substance known as β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate] (CAS number 76076-04-5) is a complex glycoside characterized by its multiple sugar units and phenolic components. This compound features a β-D-glucopyranoside moiety, which is a six-membered cyclic form of glucose, linked to an apiose furanoside and a 6-deoxy-α-L-mannopyranosyl unit. The presence of the 3,4-dihydroxyphenyl group suggests potential antioxidant properties, while the propenoate moiety indicates possible reactivity in various chemical environments. The structural complexity of this compound may contribute to its biological activities, including potential roles in plant defense mechanisms or as a bioactive compound in medicinal chemistry. Its solubility and stability would depend on the specific conditions, such as pH and temperature, making it of interest for further research in pharmacology and biochemistry.
Formula:C34H44O19
InChI:InChI=1S/C34H44O19/c1-15-24(42)28(52-33-30(45)34(46,13-36)14-48-33)25(43)32(49-15)53-29-26(44)31(47-9-8-17-3-6-19(38)21(40)11-17)50-22(12-35)27(29)51-23(41)7-4-16-2-5-18(37)20(39)10-16/h2-7,10-11,15,22,24-33,35-40,42-46H,8-9,12-14H2,1H3
InChI key:InChIKey=KAKUSAKVVYFENV-UHFFFAOYSA-N
SMILES:O(C1C(OC(C=CC2=CC(O)=C(O)C=C2)=O)C(CO)OC(OCCC3=CC(O)=C(O)C=C3)C1O)C4C(O)C(OC5C(O)C(CO)(O)CO5)C(O)C(C)O4
Synonyms:
  • Myricoside
  • Clerodendroside (Clerodendron myricoides)
  • Clerodendroside
  • β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
  • β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
Found 6 products.