CymitQuimica logo

CAS 760941-22-8

:

(R)-3-Amino-3-(thiophen-3-yl)propanoic acid

Description:
(R)-3-Amino-3-(thiophen-3-yl)propanoic acid is an amino acid derivative characterized by the presence of a thiophene ring, which contributes to its unique properties. This compound features a chiral center, making it exist in two enantiomeric forms, with the (R) configuration being biologically relevant in various applications. The presence of the amino group (-NH2) and the carboxylic acid group (-COOH) classifies it as an α-amino acid, which is essential for protein synthesis and can participate in various biochemical reactions. The thiophene moiety enhances its potential for interactions in biological systems, possibly influencing its solubility and reactivity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug design. Its structural characteristics suggest potential applications in the development of novel therapeutics, particularly in areas related to neurochemistry or as a building block for more complex molecules. As with many amino acid derivatives, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C7H9NO2S
InChI:InChI=1/C7H9NO2S/c8-6(3-7(9)10)5-1-2-11-4-5/h1-2,4,6H,3,8H2,(H,9,10)/t6-/m1/s1
InChI key:UPDVATYZQLTZOZ-ZCFIWIBFSA-N
SMILES:c1cscc1[C@@H](CC(=O)O)N
Synonyms:
  • (3R)-3-Amino-3-(3-thienyl)propanoic acid
  • 3-thiophenepropanoic acid, beta-amino-, (betaR)-
  • (3R)-3-amino-3-thiophen-3-ylpropanoic acid
Found 4 products.