CymitQuimica logo

CAS 761443-50-9

:

Pyrrolo[3,4-c]pyrazole-1(4H)-carboxylicacid, 5,6-dihydro-3-[[4-(4-methyl-1-piperazinyl)benzoyl]amino]-, ethyl ester

Description:
Pyrrolo[3,4-c]pyrazole-1(4H)-carboxylic acid, 5,6-dihydro-3-[[4-(4-methyl-1-piperazinyl)benzoyl]amino]-, ethyl ester, identified by CAS number 761443-50-9, is a complex organic compound characterized by its unique bicyclic structure that incorporates both pyrrole and pyrazole moieties. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and an ethyl ester group that enhances its solubility and bioavailability. The presence of a piperazine ring suggests potential pharmacological activity, as piperazine derivatives are often associated with various biological effects, including antipsychotic and antidepressant properties. The compound's structure indicates it may interact with biological targets, making it of interest in medicinal chemistry. Additionally, its synthesis and characterization would typically involve standard organic reactions, including esterification and amide formation. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with potential applications in drug development and therapeutic research.
Formula:C20H26N6O3
InChI:InChI=1S/C20H26N6O3/c1-3-29-20(28)26-17-13-21-12-16(17)18(23-26)22-19(27)14-4-6-15(7-5-14)25-10-8-24(2)9-11-25/h4-7,21H,3,8-13H2,1-2H3,(H,22,23,27)
InChI key:KLRUJKXTUJSKCG-UHFFFAOYSA-N
SMILES:CCOC(=O)N1C2=C(CNC2)C(=N1)NC(=O)C3=CC=C(C=C3)N4CCN(CC4)C
Synonyms:
  • 3-[[4-(4-Methylpiperazin-1-yl)benzoyl]amino]-1-ethoxycarbonyl-4,6-dihydro-1H-pyrrolo[3,4-c]pyrazole
Found 3 products.