CymitQuimica logo

CAS 76186-72-6

:

2,1,3-Benzothiadiazole, 4,7-dibromo-5,6-dinitro-

Description:
2,1,3-Benzothiadiazole, 4,7-dibromo-5,6-dinitro- is a heterocyclic compound characterized by its benzothiadiazole core, which features a thiadiazole ring fused to a benzene ring. This compound contains multiple functional groups, including bromine and nitro substituents, which significantly influence its chemical reactivity and physical properties. The presence of bromine atoms typically enhances the compound's stability and can impart unique electronic properties, while the nitro groups are known for their electron-withdrawing effects, which can affect the compound's reactivity in various chemical reactions. This substance is often used in research and development, particularly in the fields of organic electronics and materials science, due to its potential applications in semiconductors and dyes. Additionally, its structural characteristics may contribute to its photophysical properties, making it of interest in studies related to fluorescence and light absorption. Safety and handling precautions should be observed, as compounds with nitro and bromine groups can pose health and environmental risks.
Formula:C6Br2N4O4S
InChI:InChI=1S/C6Br2N4O4S/c7-1-3-4(10-17-9-3)2(8)6(12(15)16)5(1)11(13)14
InChI key:XEVOZPRNEPMHAF-UHFFFAOYSA-N
SMILES:C1(=C(C2=NSN=C2C(=C1[N+](=O)[O-])Br)Br)[N+](=O)[O-]
Found 7 products.