CAS 76186-72-6
:2,1,3-Benzothiadiazole, 4,7-dibromo-5,6-dinitro-
Description:
2,1,3-Benzothiadiazole, 4,7-dibromo-5,6-dinitro- is a heterocyclic compound characterized by its benzothiadiazole core, which features a thiadiazole ring fused to a benzene ring. This compound contains multiple functional groups, including bromine and nitro substituents, which significantly influence its chemical reactivity and physical properties. The presence of bromine atoms typically enhances the compound's stability and can impart unique electronic properties, while the nitro groups are known for their electron-withdrawing effects, which can affect the compound's reactivity in various chemical reactions. This substance is often used in research and development, particularly in the fields of organic electronics and materials science, due to its potential applications in semiconductors and dyes. Additionally, its structural characteristics may contribute to its photophysical properties, making it of interest in studies related to fluorescence and light absorption. Safety and handling precautions should be observed, as compounds with nitro and bromine groups can pose health and environmental risks.
Formula:C6Br2N4O4S
InChI:InChI=1S/C6Br2N4O4S/c7-1-3-4(10-17-9-3)2(8)6(12(15)16)5(1)11(13)14
InChI key:XEVOZPRNEPMHAF-UHFFFAOYSA-N
SMILES:C1(=C(C2=NSN=C2C(=C1[N+](=O)[O-])Br)Br)[N+](=O)[O-]
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4,7-Dibromo-5,6-dinitro-2,1,3-benzothiadiazole
CAS:Formula:C6Br2N4O4SPurity:>97.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:383.964,7-Dibromo-5,6-Dinitrobenzo[c][1,2,5]Thiadiazole
CAS:4,7-Dibromo-5,6-Dinitrobenzo[c][1,2,5]ThiadiazoleFormula:C6Br2N4O4SPurity:98%Color and Shape:SolidMolecular weight:383.964,7-dibromo-5,6-dinitro-2,1,3-benzothiadiazole
CAS:Formula:C6Br2N4O4SPurity:98%Color and Shape:SolidMolecular weight:383.96164,7-Dibromo-5,6-dinitrobenzo[c][1,2,5]thiadiazole
CAS:4,7-Dibromo-5,6-dinitrobenzo[c][1,2,5]thiadiazoleFormula:C6Br2N4O4SPurity:95%Molecular weight:383.964,7-Dibromo-5,6-dinitro-2,1,3-benzothiadiazole
CAS:The pentafluorophenyl group is oriented at the 4,7-dibromo-5,6-dinitro-2,1,3-benzothiadiazole (DDBT) molecule. The molecule has two orientations with respect to the pentafluorophenyl group: "trans" and "cis". The difference in energy between these two orientations is small. The technique of molecular electrostatic potential can be used to determine the orientation of a molecule. This technique shows that there is no significant difference in interaction energies for DDBT molecules with different orientations.
Formula:C6Br2N4O4SPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:383.96 g/mol4,7-DIBROMO-5,6-DINITROBENZO[C][1,2,5]THIADIAZOLE
CAS:Formula:C6Br2N4O4SPurity:98%Color and Shape:SolidMolecular weight:383.964,7-Dibromo-5,6-dintiro-2,1,3-benzothiadiazole
CAS:Controlled ProductFormula:C6Br2N4O4SColor and Shape:NeatMolecular weight:383.962






