CymitQuimica logo

CAS 762240-99-3

:

N'-(chloroacetyl)-2,2,2-trifluoroacetohydrazide

Description:
N'-(Chloroacetyl)-2,2,2-trifluoroacetohydrazide is a chemical compound characterized by its unique functional groups and fluorinated structure. It features a hydrazide moiety, which is indicative of its potential reactivity and biological activity. The presence of the chloroacetyl group suggests that it may participate in acylation reactions, while the trifluoroacetyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties such as high stability under certain conditions, but it may also be sensitive to hydrolysis due to the presence of the chloroacetyl group. Its trifluoromethyl groups can impart unique electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound's structure may allow for various synthetic modifications, potentially leading to derivatives with enhanced or altered biological activities. Overall, N'-(chloroacetyl)-2,2,2-trifluoroacetohydrazide represents a versatile scaffold for further research and development in chemical and pharmaceutical applications.
Formula:C4H4ClF3N2O2
InChI:InChI=1/C4H4ClF3N2O2/c5-1-2(11)9-10-3(12)4(6,7)8/h1H2,(H,9,11)(H,10,12)
InChI key:DYKIVKLXFDNBMY-UHFFFAOYSA-N
SMILES:C(C(=NN=C(C(F)(F)F)O)O)Cl
Found 9 products.