CymitQuimica logo

CAS 76275-14-4

:

Anthracene,9,10-dibutoxy-

Description:
Anthracene, 9,10-dibutoxy- is an organic compound characterized by its structure, which consists of an anthracene backbone with two butoxy groups attached at the 9 and 10 positions. This compound is typically a solid at room temperature and exhibits a crystalline form. It is known for its aromatic properties, which contribute to its stability and potential applications in organic electronics, such as organic light-emitting diodes (OLEDs) and photovoltaic devices. The presence of butoxy groups enhances its solubility in organic solvents, making it suitable for various chemical processes and formulations. Additionally, anthracene derivatives often display interesting photophysical properties, including fluorescence, which can be exploited in sensor technologies. However, like many organic compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, anthracene, 9,10-dibutoxy- represents a versatile compound in the field of organic chemistry and materials science.
Formula:C22H26O2
InChI:InChI=1S/C22H26O2/c1-3-5-15-23-21-17-11-7-9-13-19(17)22(24-16-6-4-2)20-14-10-8-12-18(20)21/h7-14H,3-6,15-16H2,1-2H3
InChI key:KSMGAOMUPSQGTB-UHFFFAOYSA-N
SMILES:CCCCOC1=C2C=CC=CC2=C(C3=CC=CC=C31)OCCCC
Synonyms:
  • 9,10-Dibutoxyanthracene
  • Anthracure UVS 1331
  • DBA
  • DBA (sensitizer)
  • Uvs 1331
Found 5 products.