CymitQuimica logo

CAS 76296-75-8

:

Polyphyllin VII

Description:
Polyphyllin VII is a steroidal saponin derived from the plant species of the genus Paris, particularly known for its presence in Paris polyphylla. This compound is characterized by its complex glycosidic structure, which includes a steroid backbone and multiple sugar moieties. Polyphyllin VII exhibits various biological activities, including anti-inflammatory, anti-tumor, and immunomodulatory effects, making it of interest in pharmacological research. Its mechanism of action is thought to involve the modulation of cellular signaling pathways, although specific details may vary. The compound is typically studied for its potential therapeutic applications, particularly in traditional medicine contexts. Additionally, polyphyllin VII is known for its relatively low solubility in water, which can affect its bioavailability and efficacy. As with many saponins, it may also exhibit hemolytic activity, which is a consideration in its use and study. Overall, polyphyllin VII represents a significant area of interest in natural product chemistry and pharmacognosy.
Formula:C51H84O22
InChI:InChI=1S/C51H84O22/c1-21(20-65-45-40(61)38(59)35(56)30(17-52)68-45)9-14-51(64-6)22(2)33-29(73-51)16-28-26-8-7-24-15-25(10-12-49(24,4)27(26)11-13-50(28,33)5)67-48-42(63)44(72-46-41(62)37(58)34(55)23(3)66-46)43(32(19-54)70-48)71-47-39(60)36(57)31(18-53)69-47/h7,21-23,25-48,52-63H,8-20H2,1-6H3
InChI key:InChIKey=GJHYVTIBXQFLKG-UHFFFAOYSA-N
SMILES:CC12C(C3C(CC1)C4(C)C(=CC3)CC(OC5C(O)C(OC6C(O)C(O)C(O)C(C)O6)C(OC7OC(CO)C(O)C7O)C(CO)O5)CC4)CC8C2C(C)C(CCC(COC9OC(CO)C(O)C(O)C9O)C)(OC)O8
Synonyms:
  • β-D-Glucopyranoside, (3β,22α,25R)-26-(β-D-glucopyranosyloxy)-22-methoxyfurost-5-en-3-yl O-α-L-arabinofuranosyl-(1→4)-O-[6-deoxy-α-L-mannopyranosyl-(1→3)]-
  • Polyphyllin G
  • Polyphyllin VII
  • (3β,22α,25R)-26-(β-D-Glucopyranosyloxy)-22-methoxyfurost-5-en-3-yl O-α-L-arabinofuranosyl-(1→4)-O-[6-deoxy-α-L-mannopyranosyl-(1→3)]-β-D-glucopyranoside
Found 5 products.