CymitQuimica logo

CAS 76360-82-2

:

4-Methylamino-2-Methylsulfanyl-pyrimidine-5-carboxylic acid ethyl ester

Description:
4-Methylamino-2-Methylsulfanyl-pyrimidine-5-carboxylic acid ethyl ester, with the CAS number 76360-82-2, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with a methylamino group and a methylsulfanyl group, as well as an ethyl ester functional group. The presence of these substituents contributes to its unique chemical properties, including potential biological activity. Typically, compounds of this nature may exhibit various pharmacological effects, making them of interest in medicinal chemistry. The ethyl ester moiety suggests that the compound may be more lipophilic, potentially influencing its absorption and distribution in biological systems. Additionally, the presence of both amino and carboxylic acid functionalities indicates that the compound can participate in hydrogen bonding, which may affect its solubility and reactivity. Overall, 4-Methylamino-2-Methylsulfanyl-pyrimidine-5-carboxylic acid ethyl ester is a complex molecule with potential applications in drug development and research.
Formula:C9H13N3O2S
InChI:InChI=1S/C9H13N3O2S/c1-4-14-8(13)6-5-11-9(15-3)12-7(6)10-2/h5H,4H2,1-3H3,(H,10,11,12)
InChI key:VDDZMXQAZJMGPK-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cnc([nH]c1=NC)SC
Synonyms:
  • Ethyl 4-(methylamino)-2-(methylsulfanyl)pyrimidine-5-carboxylate
Found 4 products.