CymitQuimica logo

CAS 76457-78-8

:

4-(2-methoxyethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:
4-(2-Methoxyethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 76457-78-8, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The methoxyethyl substituent enhances its solubility in organic solvents and may influence its pharmacological properties. Typically, compounds of this class are investigated for their potential applications in agriculture, particularly as fungicides or herbicides, due to their ability to interact with biological systems. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Safety and handling precautions are essential when working with this substance, as with many chemical compounds, to mitigate any potential hazards associated with its use.
Formula:C5H9N3OS
InChI:InChI=1/C5H9N3OS/c1-9-3-2-8-4-6-7-5(8)10/h4H,2-3H2,1H3,(H,7,10)
SMILES:COCCn1cnnc1S
Synonyms:
  • 4-(2-methoxyethyl)-4H-1,2,4-triazole-3-thiol
Found 1 products.