CymitQuimica logo

CAS 7652-29-1

:

6-chloro-2H-1,4-benzoxazin-3(4H)-one

Description:
6-Chloro-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 7652-29-1, is a heterocyclic organic compound characterized by its benzoxazine structure, which features a fused benzene and oxazine ring. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential applications in various fields, including agriculture as a herbicide and in the synthesis of other organic compounds. The presence of the chloro substituent at the 6-position of the benzoxazine ring influences its reactivity and biological activity. The compound is generally soluble in organic solvents, but its solubility in water is limited. Its chemical properties include the ability to undergo various reactions such as nucleophilic substitution and cyclization, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit biological activities, including antimicrobial and antifungal properties, which are of interest in pharmaceutical research. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H6ClNO2
InChI:InChI=1/C8H6ClNO2/c9-5-1-2-7-6(3-5)10-8(11)4-12-7/h1-3H,4H2,(H,10,11)
InChI key:OBPIPKQQNRACHV-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Cl)N=C(CO2)O
Synonyms:
  • 2H-1,4-Benzoxazin-3(4H)-one, 6-chloro-
  • 6-chloro-2H-benzo[b][1,4]oxazin-3(4H)-one
  • 6-Chloro-2H-1,4-benzoxazin-3(4H)-one
Found 4 products.