CymitQuimica logo

CAS 765878-69-1

:

1-(1-benzylpyrrolidin-3-yl)piperazine

Description:
1-(1-benzylpyrrolidin-3-yl)piperazine, identified by its CAS number 765878-69-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic compound containing two nitrogen atoms, and is substituted with a benzyl group and a pyrrolidine moiety. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound is typically characterized by its molecular structure, which influences its solubility, stability, and reactivity. It may exhibit properties such as being a potential ligand for various receptors, which could lead to applications in drug development. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Safety and handling considerations are essential, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C15H23N3
InChI:InChI=1/C15H23N3/c1-2-4-14(5-3-1)12-17-9-6-15(13-17)18-10-7-16-8-11-18/h1-5,15-16H,6-13H2
InChI key:QRCCCCZXXGZOGG-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN1CCC(C1)N1CCNCC1
Found 3 products.