CymitQuimica logo

CAS 765891-92-7

:

3-(4-methylpiperidin-1-yl)propanoic acid

Description:
3-(4-Methylpiperidin-1-yl)propanoic acid is an organic compound characterized by its structure, which includes a propanoic acid moiety attached to a 4-methylpiperidine ring. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties and allows for hydrogen bonding, enhancing its solubility in polar solvents. The presence of the piperidine ring contributes to its basicity and potential interactions with biological systems, making it of interest in medicinal chemistry. The methyl group on the piperidine ring can influence the compound's steric and electronic properties, potentially affecting its pharmacological activity. Additionally, the compound may exhibit moderate lipophilicity due to the hydrophobic piperidine structure, which can impact its absorption and distribution in biological systems. Overall, 3-(4-methylpiperidin-1-yl)propanoic acid is a versatile compound with potential applications in drug development and synthesis, particularly in the context of designing molecules that interact with specific biological targets.
Formula:C9H17NO2
InChI:InChI=1/C9H17NO2/c1-8-2-5-10(6-3-8)7-4-9(11)12/h8H,2-7H2,1H3,(H,11,12)
InChI key:POZODKNKLOJGEK-UHFFFAOYSA-N
SMILES:CC1CCN(CC1)CCC(=O)O
Synonyms:
  • 1-Piperidinepropanoic acid, 4-methyl-
  • 3-(4-Methylpiperidin-1-yl)propanoic acid
Found 3 products.