CymitQuimica logo

CAS 76660-37-2

:

4-[(5-bromopyrimidin-2-yl)oxy]aniline

Description:
4-[(5-Bromopyrimidin-2-yl)oxy]aniline, with the CAS number 76660-37-2, is an organic compound characterized by its structure, which includes a brominated pyrimidine moiety and an aniline group. This compound typically exhibits properties associated with both aromatic amines and halogenated heterocycles. It is likely to be a solid at room temperature, with moderate solubility in polar organic solvents due to the presence of the aniline functional group. The bromine atom introduces a degree of electrophilicity, which can influence its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The pyrimidine ring contributes to the compound's potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the ether linkage (the -O- group connecting the pyrimidine and aniline) can affect the compound's electronic properties and steric hindrance, influencing its interactions in biological systems. Overall, this compound's unique structural features make it a valuable candidate for further research in various chemical and pharmaceutical applications.
Formula:C10H8BrN3O
InChI:InChI=1/C10H8BrN3O/c11-7-5-13-10(14-6-7)15-9-3-1-8(12)2-4-9/h1-6H,12H2
InChI key:NZWKWSKOAISTNU-UHFFFAOYSA-N
SMILES:c1cc(ccc1N)Oc1ncc(cn1)Br
Synonyms:
  • Benzenamine, 4-[(5-Bromo-2-Pyrimidinyl)Oxy]-
  • 4-[(5-Bromopyrimidin-2-yl)oxy]aniline
  • 4-(5-bromopyrimidin-2-yloxy)benzenamine
  • 4-[(5-bromo-2-pyrimidinyl)oxy]Benzenamine
  • 4-[(5-Bromo-2-pyrimidinyl)oxy]aniline
  • 4-(5-Bromopyrimidin-2-yloxy)phenylamine
  • 4-(5-bromopyrimidin-2-yloxy)benzenamine ISO 9001:2015 REACH
Found 4 products.