CAS 767-62-4
:1,2,4-Triazolo[4,3-a]pyridin-3-amine
Description:
1,2,4-Triazolo[4,3-a]pyridin-3-amine is a heterocyclic compound characterized by its fused triazole and pyridine rings. This compound features a triazole ring, which consists of three nitrogen atoms and two carbon atoms, fused to a pyridine ring, a six-membered aromatic ring containing one nitrogen atom. The presence of an amino group (-NH2) at the 3-position of the pyridine ring enhances its reactivity and solubility in polar solvents. This compound is often studied for its potential biological activities, including antimicrobial and antitumor properties, making it of interest in medicinal chemistry. Its structural features contribute to its ability to interact with various biological targets. Additionally, 1,2,4-Triazolo[4,3-a]pyridin-3-amine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Overall, this compound exemplifies the diverse chemistry of nitrogen-containing heterocycles and their applications in drug discovery and development.
Formula:C6H6N4
InChI:InChI=1/C6H6N4/c7-6-9-8-5-3-1-2-4-10(5)6/h1-4H,(H2,7,9)
SMILES:c1ccn2c(c1)n[nH]c2=N
Synonyms:- 3-Amino-1,2,4-triazolo[4,3-a]pyridine
- tert-butyl 2-chloro-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
[1,2,4]triazolo[4,3-a]pyridin-3-amine
CAS:[1,2,4]triazolo[4,3-a]pyridin-3-amineFormula:C6H6N4Purity:97%Molecular weight:134.141,2,4-Triazolo[4,3-a]pyridin-3-amine
CAS:Formula:C6H6N4Purity:95%Color and Shape:SolidMolecular weight:134.1386[1,2,4]Triazolo[4,3-a]pyridin-3-amine
CAS:[1,2,4]Triazolo[4,3-a]pyridin-3-amineFormula:C6H6N4Purity:95%Molecular weight:134.14[1,2,4]Triazolo[4,3-a]pyridin-3-amine
CAS:[1,2,4]Triazolo[4,3-a]pyridin-3-amine is a heterocyclic compound that has been synthesized from hydrazine and isothiocyanate. The reaction proceeds via an oxidative coupling of the hydrazine with the isothiocyanate. This reaction is scalable, efficient, and can be performed using a variety of substrates. The synthesis of this compound can be followed in a stepwise manner and it has been shown to undergo reactions that are sequential and efficient.Formula:C6H6N4Purity:Min. 95%Molecular weight:134.14 g/mol




