CymitQuimica logo

CAS 768343-60-8

:

3-(aminomethyl)-N-methylaniline

Description:
3-(Aminomethyl)-N-methylaniline, also known by its CAS number 768343-60-8, is an organic compound characterized by the presence of an amino group and a methylaniline structure. This compound features a primary amine (-NH2) group attached to a benzene ring, which is further substituted with a methyl group and an aminomethyl group. It typically appears as a colorless to light yellow liquid or solid, depending on its purity and form. The presence of both amino and methyl groups contributes to its potential as a building block in organic synthesis, particularly in the production of dyes, pharmaceuticals, and agrochemicals. The compound is likely to exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, it may have moderate solubility in polar solvents, which can influence its reactivity and applications in different chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H12N2
InChI:InChI=1/C8H12N2/c1-10-8-4-2-3-7(5-8)6-9/h2-5,10H,6,9H2,1H3
InChI key:XDEDGESLTYFNGL-UHFFFAOYSA-N
SMILES:CNc1cccc(c1)CN
Synonyms:
  • Benzenemethanamine, 3-(methylamino)-
Found 4 products.