CymitQuimica logo

CAS 76876-70-5

:

1-Benzyl-4-(2-hydroxyethyl)piperidine

Description:
1-Benzyl-4-(2-hydroxyethyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The structure features a benzyl group attached to the nitrogen atom of the piperidine, and a hydroxyethyl group attached to the fourth carbon of the ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the hydroxyethyl group, which can engage in hydrogen bonding. The presence of both the benzyl and hydroxyethyl substituents contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, which can accept protons. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H21NO
InChI:InChI=1/C14H21NO/c16-11-8-13-6-9-15(10-7-13)12-14-4-2-1-3-5-14/h1-5,13,16H,6-12H2
InChI key:FBFPTWSKNJHCGT-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN1CCC(CC1)CCO
Synonyms:
  • 2-(1-Benzylpiperidin-4-Yl)Ethanol
Found 3 products.