CAS 76877-93-5
:Benzenemethanethiol, a-ethyl-
Description:
Benzenemethanethiol, α-ethyl- (CAS 76877-93-5) is an organic compound characterized by the presence of a thiol (-SH) group attached to a benzene ring, with an ethyl group substituent. This compound belongs to the class of aromatic thiols, which are known for their distinctive odors and potential applications in various fields, including pharmaceuticals and materials science. The structure features a benzene ring bonded to a methanethiol group, where the sulfur atom contributes to the compound's reactivity and potential for forming disulfide bonds. Benzenemethanethiol, α-ethyl- may exhibit properties such as moderate volatility and solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic character. Its thiol functionality can participate in nucleophilic reactions, making it useful in organic synthesis. Additionally, the compound's odor can be significant, often described as pungent or sulfurous, which is typical for thiols. Safety precautions should be taken when handling this substance, as thiols can be toxic and irritating to the skin and respiratory system.
Formula:C9H12S
InChI:InChI=1S/C9H12S/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3
InChI key:WKTSFRBEJWLNKI-UHFFFAOYSA-N
SMILES:CCC(C1=CC=CC=C1)S
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Phenylpropane-1-thiol
CAS:1-Phenylpropane-1-thiol is a thiol compound that can reversibly bind to disulphide bonds. It has been shown to have antimicrobial and anti-infective properties against bacteria, fungi, and viruses. The ethyl group on the 1-phenylpropane-1-thiol molecule allows it to be used as a coating for metals such as aluminum or stainless steel. This compound can also be used in the production of pharmaceuticals and other organic molecules. Biological properties of 1-phenylpropane-1-thiol include its ability to inhibit protein synthesis by binding to the ribosome and preventing peptide elongation. It is also active oxygen species with the ability to react with free radicals, including hydroxyl radicals and superoxide anions.Formula:C9H12SPurity:Min. 95%Molecular weight:152.26 g/mol


