CAS 76880-29-0
:N(alpha)-boc-S-(3-nitro-2-pyridylthio)-L-cysteine
Description:
N(alpha)-Boc-S-(3-nitro-2-pyridylthio)-L-cysteine is a derivative of the amino acid L-cysteine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group on the amino group and a 3-nitro-2-pyridylthio moiety attached to the sulfur atom. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to form disulfide bonds and participate in various biochemical reactions. The Boc group serves to protect the amino group during synthesis, allowing for selective reactions at other functional sites. The 3-nitro-2-pyridylthio group enhances the compound's reactivity and can facilitate interactions with biological targets, making it of interest in drug development. The presence of the nitro group also introduces electron-withdrawing characteristics, which can influence the compound's overall reactivity and solubility. As with many sulfur-containing compounds, it may exhibit unique properties such as increased nucleophilicity and potential for redox reactions. Proper handling and storage conditions are essential due to the potential reactivity of the thiol group.
Formula:C13H17N3O6S2
InChI:InChI=1/C13H17N3O6S2/c1-13(2,3)22-12(19)15-8(11(17)18)7-23-24-10-9(16(20)21)5-4-6-14-10/h4-6,8H,7H2,1-3H3,(H,15,19)(H,17,18)/t8-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CSSc1c(cccn1)N(=O)=O)C(=O)O)O
Synonyms:- Boc-Cys(Npys)-OH
- N-(tert-butoxycarbonyl)-3-[(3-nitropyridin-2-yl)disulfanyl]-L-alanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Boc-Cys(NPys)-OH
CAS:Npys allows site-directed disulfide bond formation, as it is cleaved by thiols. Galande and Spatola obtained disulfide heterodimers of peptides via coupling Boc-Cys(NPys)-OH together with Fmoc-Cys(Mmt)-OH to MBHA-resin followed by Mmt removal with 1% TFA in dichloromethane. Mourier et al. used BCNP for the identification of T-cell epitopes in Cys and/or Cyt-containing proteins.Formula:C13H17N3O6S2Purity:> 99%Color and Shape:Yellow PowderMolecular weight:375.43L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-3-[(3-nitro-2-pyridinyl)dithio]-
CAS:Formula:C13H17N3O6S2Purity:98%Color and Shape:SolidMolecular weight:375.4206Boc-cys(Npys)-oh
CAS:Boc-cys(Npys)-oh is an active substance that inhibits the growth of mouse tumors and has been shown to inhibit a number of different biological processes. It is a cross-linking agent for amino acids and has been shown to have an inhibitory effect on the synthesis of proteins by blocking the formation of disulfide bonds. This compound belongs to the class of chemicals known as sulfonamides, which are used in the treatment of bacterial infections. Boc-cys(Npys)-oh also specifically binds to antigen sites on cells, inhibiting their growth, and can be used as an antitumor agent. The molecule can be chemically linked with other molecules such as trifluoroacetic acid (TFA), resulting in a product with different properties than those found in Boc-cys(Npys)-oh. The chemical ligation process is used to produce subcutaneous tumors in mice that are then treated with hydrogen fluoride (Formula:C13H17N3O6S2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:375.42 g/mol





