CymitQuimica logo

CAS 77087-60-6

:

3-[[(1,1-Dimethylethoxy)carbonyl]amino]-L-alanine methyl ester

Description:
3-[[(1,1-Dimethylethoxy)carbonyl]amino]-L-alanine methyl ester, with the CAS number 77087-60-6, is an amino acid derivative characterized by its unique structure that includes an L-alanine backbone modified with a dimethylethoxycarbonyl group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its molecular structure features both an amino group and a carboxyl group, which are characteristic of amino acids, allowing it to participate in various chemical reactions, including peptide bond formation. The presence of the dimethylethoxycarbonyl group enhances its stability and solubility, making it useful in peptide synthesis and as a building block in organic chemistry. Additionally, this compound may exhibit specific biological activities due to its amino acid nature, potentially influencing its application in pharmaceuticals or biochemistry. As with many chemical substances, proper handling and safety precautions should be observed, as it may have specific reactivity or toxicity profiles.
Formula:C9H18N2O4
InChI:InChI=1/C9H18N2O4/c1-9(2,3)15-8(13)11-5-6(10)7(12)14-4/h6H,5,10H2,1-4H3,(H,11,13)/t6-/m0/s1
InChI key:AXLHVTKGDPVANO-LURJTMIESA-N
SMILES:CC(C)(C)OC(=NC[C@@H](C(=O)OC)N)O
Synonyms:
  • L-alanine, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester
  • Methyl 3-[(tert-butoxycarbonyl)amino]-L-alaninate
  • H-L-Dap(Boc)-OMe
Found 6 products.