CAS 771-99-3
:4-Phenylpiperidine
Description:
4-Phenylpiperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted at the 4-position with a phenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It has a molecular formula of C13H17N and a molecular weight of approximately 189.28 g/mol. 4-Phenylpiperidine is known for its psychoactive properties and has been studied for its potential applications in medicinal chemistry, particularly in the development of analgesics and other therapeutic agents. The compound exhibits basic properties due to the presence of the nitrogen atom in the piperidine ring, allowing it to form salts with acids. Its solubility is generally higher in organic solvents than in water. Safety considerations should be taken into account when handling this compound, as it may pose health risks if ingested or inhaled. Proper laboratory protocols and personal protective equipment are recommended during its use.
Formula:C11H15N
InChI:InChI=1S/C11H15N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-5,11-12H,6-9H2
InChI key:InChIKey=UTBULQCHEUWJNV-UHFFFAOYSA-N
SMILES:C1(=CC=CC=C1)C2CCNCC2
Synonyms:- 4-Phenyl-Piperidine
- 4-Phenylpiperidinium
- Nsc 89743
- Piperidine, 4-phenyl-
- 4-Phenylpiperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Phenylpiperidine
CAS:Formula:C11H15NPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:161.254-Phenylpiperidine
CAS:4-PhenylpiperidineFormula:C11H15NPurity:97%Color and Shape:Beige SolidMolecular weight:161.24354-Phenyl-piperidine
CAS:4-Phenyl-piperidine is a nitro compound that has been shown to be toxic for the kidneys and nervous system. 4-Phenyl-piperidine has been shown to inhibit dopamine uptake in the striatum and locomotor activity in rats. It also inhibits the hydrolysis of hydrochloric acid, which produces hydrogen ion (H+) ions, resulting in an acidic environment. The chemical structures of 4-phenyl-piperidine are similar to those of tricyclic antidepressants drugs, such as amitriptyline and imipramine, with a phenyl ring attached to an amine group. This drug is used as a pharmaceutical preparation for treating depression by inhibiting the reuptake of serotonin and norepinephrine, which are neurotransmitters that affect mood.Formula:C11H15NPurity:Min. 95%Molecular weight:161.24 g/mol






