CAS 77284-32-3
:Fmoc-L-Norleucine
Description:
Fmoc-L-Norleucine is a derivative of the amino acid norleucine, which is an analog of leucine. The "Fmoc" (9-fluorenylmethoxycarbonyl) group is a common protective group used in peptide synthesis, allowing for the selective protection of the amino group during the formation of peptide bonds. This compound is characterized by its hydrophobic nature due to the presence of the norleucine side chain, which contributes to its role in influencing the folding and stability of peptides. Fmoc-L-Norleucine is typically utilized in solid-phase peptide synthesis, where the Fmoc group can be easily removed under basic conditions, facilitating the sequential addition of amino acids. The compound is generally stable under standard laboratory conditions but should be stored in a cool, dry place to prevent degradation. Its applications extend to research in biochemistry and molecular biology, particularly in the design of peptides with specific structural and functional properties.
Formula:C21H22NO4
InChI:InChI=1/C21H23NO4/c1-2-3-12-19(20(23)24)22-21(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,2-3,12-13H2,1H3,(H,22,25)(H,23,24)/p-1/t19-/m1/s1
SMILES:CCCC[C@H](C(=O)[O-])N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- N-alpha-9-Fluorenylmethoxycarbonyl-L-norleucine
- Fmoc-Nle-OH
- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-norleucine
- (2R)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Fmoc-Nle-OH
CAS:Formula:C21H23NO4Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:353.42Fmoc-Nle-OH
CAS:Bachem ID: 4004485.
Formula:C21H23NO4Purity:99.90%Color and Shape:WhiteMolecular weight:353.42N-(9-Fluorenylmethoxycarbonyl)-L-norleucine
CAS:Formula:C21H23NO4Purity:98%Color and Shape:SolidMolecular weight:353.4116(2S)-2-(9H-Fluoren-9-ylmethoxycarbonylamino)hexanoic acid
CAS:(2S)-2-(9H-Fluoren-9-ylmethoxycarbonylamino)hexanoic acidFormula:C21H23NO4Purity:98%Color and Shape:SolidMolecular weight:353.41161Fmoc-L-norleucine
CAS:Fmoc-L-norleucine is a non-natural amino acid that can be used to study the interactions of proteins with cellular receptors. It is synthesized from methylandrostenediol and caproic acid, which are then reacted with sodium salt. The resultant product contains a tertiary amine group that interacts with the surface receptor. Fmoc-L-norleucine has shown affinity for endogenous ligands such as nucleobases and phospholipids on cell membranes. In addition, it has been shown to interact with other proteins through its side chain, including erythrocyte band 3 protein. Fmoc-L-norleucine also has a high affinity for binding to divalent metal ions such as calcium and magnesium in aqueous solution, giving it potential applications in the field of analytical chemistry.Formula:C21H23NO4Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:353.41 g/molFMOC-L-Norleucine extrapure, 99%
CAS:Formula:C21H23NO4Purity:min. 99%Color and Shape:White, Crystalline powderMolecular weight:353.40FMOC-NLE-OH
CAS:Formula:C21H23NO4Purity:98%Color and Shape:Solid, CrystallineMolecular weight:353.418







