CAS 77326-36-4
:2-Amino-6-fluorobenzonitrile
Description:
2-Amino-6-fluorobenzonitrile, with the CAS number 77326-36-4, is an organic compound characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a benzene ring that also contains a nitrile group (-C≡N). This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique structural features. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the nitrile group contributes to its reactivity and ability to form various derivatives. The fluorine atom can influence the compound's electronic properties, making it a valuable building block in medicinal chemistry. Additionally, 2-amino-6-fluorobenzonitrile may exhibit specific biological activities, which are of interest in drug development. As with many chemical substances, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C7H5FN2
InChI:InChI=1S/C7H5FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,10H2
InChI key:InChIKey=IQUNZGOZUJITBJ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(F)C=CC=C1N
Synonyms:- 2-Cyano-3-fluorophenylamine
- 6-Amino-2-fluorobenzenecarbonitrile
- 6-Fluoro-2-aminobenzonitrile
- 6-Fluoroanthranilonitrile
- Benzonitrile, 2-amino-6-fluoro-
- N-[tert-butyl(dimethyl)silyl]-2,2,2-trifluoro-N-methylacetamide
- 2-Amino-6-fluorobenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Amino-6-fluorobenzonitrile
CAS:Formula:C7H5FN2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:136.132-Amino-6-fluorobenzonitrile
CAS:2-Amino-6-fluorobenzonitrileFormula:C7H5FN2Purity:98%Color and Shape:Cream SolidMolecular weight:136.12642-Amino-6-fluorobenzonitrile
CAS:Formula:C7H5FN2Purity:98%Color and Shape:SolidMolecular weight:136.12642-Amino-6-fluorobenzonitrile
CAS:2-Amino-6-fluorobenzonitrile is a synthetic compound that belongs to the class of quinazolinones. It is an active compound that can be used as a precursor in the synthesis of other quinazolinones. The molecular modeling has shown that this compound binds to nucleophilic sites on enzymes, such as thiol groups and hydroxyl groups, which are found on cysteine residues or serine residues in proteins. 2-Amino-6-fluorobenzonitrile also has an organometallic character due to its ability to form hydrogen bonds with neighboring molecules. The thermal denaturation of this molecule has been studied using L6 cells and 3-bromo-2-fluorobenzoic acid (BFB) as a probe.Formula:C7H5FN2Purity:Min. 95%Color and Shape:PowderMolecular weight:136.13 g/mol2-Amino-6-fluorobenzonitrile
CAS:Formula:C7H5FN2Purity:97%Color and Shape:SolidMolecular weight:136.129






