CAS 7734-80-7
:Coumarin-6-carboxylic acid
Description:
Coumarin-6-carboxylic acid is an organic compound belonging to the coumarin family, characterized by its aromatic structure and the presence of a carboxylic acid functional group. It typically appears as a white to pale yellow crystalline solid and is known for its fluorescent properties, making it useful in various applications, including as a fluorescent probe in biological studies. The compound is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. Coumarin-6-carboxylic acid exhibits moderate stability under standard conditions but may undergo degradation when exposed to strong acids or bases. Its fluorescence can be influenced by pH and solvent polarity, which is significant for its use in fluorescence microscopy and imaging techniques. Additionally, it has potential applications in the fields of pharmaceuticals, agrochemicals, and as a dye in various industrial processes. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H6O4
InChI:InChI=1/C10H6O4/c11-9-4-2-6-5-7(10(12)13)1-3-8(6)14-9/h1-5H,(H,12,13)
SMILES:c1cc2c(ccc(=O)o2)cc1C(=O)O
Synonyms:- 2-oxo-2H-chromene-6-carboxylic acid
- 2-oxochromene-6-carboxylicaci
- 2-oxochromene-6-carboxylic acid
- Coumarin-6-carboxylic acid
- 2-oxo-2H-1-Benzopyran-6-carboxylic acid
- Coumarin-6-carboxylic acid ISO 9001:2015 REACH
- 2-oxo-1-benzopyran-6-carboxylic acid
- 2H-1-Benzopyran-6-carboxylicacid, 2-oxo-
- 2-oxo-1H-chromene-6-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Oxo-2H-chromene-6-carboxylic acid
CAS:2-Oxo-2H-chromene-6-carboxylic acidFormula:C10H6O4Purity:98%Molecular weight:190.152232-Oxo-2H-chromene-6-carboxylic acid
CAS:Formula:C10H6O4Purity:98%Color and Shape:SolidMolecular weight:190.15222-Oxo-2H-chromene-6-carboxylic acid
CAS:2-Oxo-2H-chromene-6-carboxylic acid is a cytosolic enzyme that catalyzes the oxidation of a variety of substrates. It has been shown to have a high specificity for active oxygen, such as hydrogen peroxide and superoxide. The enzyme also has fluorescence properties that are used in biomedical research to study the cytosol in living cells. 2-Oxo-2H-chromene-6-carboxylic acid has been shown to inhibit tumor growth and cancer therapy by inducing apoptosis, or programmed cell death, in human serum and cancer cells. To date, this enzyme has not been studied extensively in animals or humans.
Formula:C10H6O4Purity:Min. 95%Color and Shape:PowderMolecular weight:190.15 g/mol2-Oxo-2H-chromene-6-carboxylic acid
CAS:Formula:C10H6O4Purity:98%Color and Shape:SolidMolecular weight:190.154



