CymitQuimica logo

CAS 773873-72-6

:

methyl 3,4,5-trifluorobenzoate

Description:
Methyl 3,4,5-trifluorobenzoate is an aromatic ester characterized by the presence of a benzoate group with three fluorine atoms substituted at the 3, 4, and 5 positions on the benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its relatively low volatility and moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. The trifluoromethyl groups enhance its chemical stability and influence its reactivity, making it useful in various synthetic applications, particularly in the pharmaceutical and agrochemical industries. Methyl 3,4,5-trifluorobenzoate can participate in nucleophilic substitution reactions and is often employed as an intermediate in the synthesis of more complex fluorinated compounds. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper safety protocols should be followed when working with this substance.
Formula:C8H5F3O2
InChI:InChI=1/C8H5F3O2/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3H,1H3
InChI key:NBBPHMUHCCIOJQ-UHFFFAOYSA-N
SMILES:COC(=O)c1cc(c(c(c1)F)F)F
Synonyms:
  • Benzoic Acid, 3,4,5-Trifluoro-, Methyl Ester
Found 4 products.