CymitQuimica logo

CAS 7746-27-2

:

1H-Indazole, 6-broMo-3-Methyl-

Description:
1H-Indazole, 6-bromo-3-methyl- is an organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 6-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic nature. Its structure allows for potential reactivity in various chemical reactions, including electrophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Additionally, compounds like 1H-Indazole, 6-bromo-3-methyl- may exhibit biological activity, which can be explored for pharmaceutical applications. Safety data sheets should be consulted for handling precautions, as halogenated compounds can pose health risks. Overall, this compound represents a valuable building block in the synthesis of more complex molecules in research and industrial applications.
Formula:C8H7BrN2
InChI:InChI=1S/C8H7BrN2/c1-5-7-3-2-6(9)4-8(7)11-10-5/h2-4H,1H3,(H,10,11)
InChI key:PUVRYFUBGFMXMW-UHFFFAOYSA-N
SMILES:CC1=C2C=CC(=CC2=NN1)Br
Synonyms:
  • 6-Bromo-3-Methyl Indazole
  • 2H-Indazole, 6-bromo-3-methyl-
  • 6-Bromo-3-Methyl-1H-Indazole
Found 5 products.