CymitQuimica logo

CAS 774608-49-0

:

Benzene, 4-bromo-1-chloro-2-iodo-

Description:
Benzene, 4-bromo-1-chloro-2-iodo- is an aromatic halogenated compound characterized by the presence of three halogen substituents on a benzene ring. Specifically, it features a bromine atom at the para position, a chlorine atom at the meta position, and an iodine atom at the ortho position relative to each other. This compound is likely to exhibit typical properties of halogenated benzenes, including increased reactivity due to the presence of electronegative halogens, which can influence its chemical behavior in reactions such as nucleophilic substitution or electrophilic aromatic substitution. The presence of multiple halogens can also affect its physical properties, such as solubility and boiling point, compared to unsubstituted benzene. Additionally, the compound may have applications in organic synthesis and materials science, given the reactivity of halogenated compounds in forming new chemical bonds. Safety considerations should be taken into account due to the potential toxicity and environmental impact of halogenated organic compounds.
Formula:C6H3BrClI
InChI:InChI=1S/C6H3BrClI/c7-4-1-2-5(8)6(9)3-4/h1-3H
InChI key:JNVDPJAUWVJWAB-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Br)I)Cl
Found 5 products.