CymitQuimica logo

CAS 77471-41-1

:

H-Ala-AMC

Description:
H-Ala-AMC, also known as L-Alanine 7-amido-4-methylcoumarin, is a synthetic compound commonly used in biochemical research, particularly in the study of proteolytic enzymes. This substance features a structure that includes an alanine amino acid moiety linked to a 7-amido-4-methylcoumarin fluorophore, which allows for fluorescence-based assays. The compound is characterized by its ability to serve as a substrate for various proteases, enabling the monitoring of enzyme activity through the release of the fluorescent product upon cleavage. H-Ala-AMC is typically soluble in water and organic solvents, making it versatile for laboratory applications. Its fluorescence properties are advantageous for real-time monitoring in enzymatic reactions, providing insights into enzyme kinetics and mechanisms. As with many biochemical reagents, proper handling and storage conditions are essential to maintain its stability and efficacy in experimental settings.
Formula:C13H14N2O3
InChI:InChI=1S/C13H14N2O3/c1-7-5-12(16)18-11-6-9(3-4-10(7)11)15-13(17)8(2)14/h3-6,8H,14H2,1-2H3,(H,15,17)/t8-/m0/s1
InChI key:IWSOXHMIRLSLKT-QMMMGPOBSA-N
SMILES:CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C)N
Found 8 products.