CAS 776297-69-9
:1-(3-Methylbutyl) 2-pentyl 1,2-benzenedicarboxylate
Description:
1-(3-Methylbutyl) 2-pentyl 1,2-benzenedicarboxylate, with the CAS number 776297-69-9, is an organic compound that belongs to the class of benzenedicarboxylates. This substance features a complex structure characterized by a benzene ring substituted with two carboxylate groups and alkyl side chains, specifically a 3-methylbutyl group and a pentyl group. The presence of these alkyl groups contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. The compound is likely to exhibit properties typical of esters, such as pleasant odors and potential applications in flavoring or fragrance industries. Additionally, due to its structural characteristics, it may possess specific physical properties like a moderate boiling point and viscosity. Its potential uses could extend to plasticizers or additives in various formulations, although detailed studies on its toxicity and environmental impact would be necessary to fully understand its safety profile. Overall, this compound exemplifies the diversity of organic chemistry and the functionalization of aromatic systems.
Formula:C18H26O4
InChI:InChI=1S/C18H26O4/c1-4-5-8-12-21-17(19)15-9-6-7-10-16(15)18(20)22-13-11-14(2)3/h6-7,9-10,14H,4-5,8,11-13H2,1-3H3
InChI key:InChIKey=MCXWUHMDAJQKBI-UHFFFAOYSA-N
SMILES:C(OCCC(C)C)(=O)C1=C(C(OCCCCC)=O)C=CC=C1
Synonyms:- 1,2-Benzenedicarboxylic acid, 1-(3-methylbutyl) 2-pentyl ester
- 1,2-Benzenedicarboxylic acid, 3-methylbutyl pentyl ester
- 1-(3-Methylbutyl) 2-pentyl 1,2-benzenedicarboxylate
- 3-Methylbutyl pentyl phthalate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Isopentyl pentyl phthalate
CAS:Controlled ProductIsopentyl pentyl phthalateFormula:C18H26O4Purity:97%Color and Shape:LiquidMolecular weight:306.4Isopentyl pentyl phthalate
CAS:Controlled ProductFormula:C18H26O4Purity:97%Color and Shape:LiquidMolecular weight:306.3966Phthalic acid, n-pentyl-isopentyl ester
CAS:Controlled ProductFormula:C18H26O4Color and Shape:NeatMolecular weight:306.40Isopentyl Pentyl Phthalate
CAS:Controlled ProductApplications One of the several phthalate esters which showed clear fetotoxicity, embryolethality and teratogenicity.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C18H26O4Color and Shape:NeatMolecular weight:306.4





