CAS 7766-86-1

Formula: C7H11NO3

InChI: InChI=1S/C7H11NO3/c9-6-3-1-5(8-6)2-4-7(10)11/h5H,1-4H2,(H,8,9)(H,10,11)

InChI key: CSBJIXVKDCZBPF-UHFFFAOYSA-N

SMILES: C1CC(=O)NC1CCC(=O)O

3-(5-Oxopyrrolidin-2-yl)propanoic acid

CAS: 7766-86-1

3-(5-Oxopyrrolidin-2-yl)propanoic acid

Formula: C₇H₁₁NO₃

Purity: 95%

Molecular weight: 157.17

Ref: 54-OR1076889

3-(5-Oxopyrrolidin-2-yl)propanoic acid

CAS: 7766-86-1

Formula: C₇H₁₁NO₃

Molecular weight: 157.1671

Ref: IN-DA008OS4

3-(5-Oxo-pyrrolidin-2-yl)-propionic acid

CAS: 7766-86-1

Formula: C₇H₁₁NO₃

Purity: 95+%

Color and Shape: Solid

Molecular weight: 157.169

Ref: 10-F038597

5-Oxo-2-pyrrolidinepropanoic Acid

Controlled Product

CAS: 7766-86-1

Formula: C₇H₁₁NO₃

Color and Shape: Neat

Molecular weight: 157.167

Ref: TR-O859605

3-(5-Oxo-pyrrolidin-2-yl)-propionic acid

CAS: 7766-86-1

3-(5-Oxo-pyrrolidin-2-yl)-propionic acid is a pharmacological agent that is used for animal studies. This drug is an activator of the glutamatergic system, which plays a role in cognition. 3-(5-Oxo-pyrrolidin-2-yl)-propionic acid was found to increase the number of methyl groups in rats and mice, which may be due to its ability to activate the enzyme methoxy radical. 3-(5-Oxo-pyrrolidin-2-yl)-propionic acid increases the amount of lactam in tissues, leading to increased production of amide, which may also increase cognitive function.

Formula: C₇H₁₁NO₃

Purity: Min. 95%

Molecular weight: 157.17 g/mol

Ref: 3D-HAA76686