CAS 77697-23-5
:N-(4-Hydroxybenzoyl)glycyl-L-histidyl-L-leucine
Description:
N-(4-Hydroxybenzoyl)glycyl-L-histidyl-L-leucine, with the CAS number 77697-23-5, is a synthetic peptide derivative characterized by its unique combination of amino acids and a hydroxybenzoyl moiety. This compound features a peptide bond linking glycine, L-histidine, and L-leucine, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of the 4-hydroxybenzoyl group enhances its solubility and stability, making it suitable for various biochemical applications. The compound may exhibit properties such as antioxidant activity, which is often associated with phenolic compounds, and it may interact with biological systems through mechanisms involving enzyme inhibition or receptor modulation. Its structural complexity allows for potential use in drug design, particularly in targeting specific biological pathways. As with many peptides, its stability and bioavailability can be influenced by factors such as pH and temperature, which are important considerations in its application in therapeutic contexts.
Formula:C21H27N5O6
InChI:InChI=1S/C21H27N5O6/c1-12(2)7-17(21(31)32)26-20(30)16(8-14-9-22-11-24-14)25-18(28)10-23-19(29)13-3-5-15(27)6-4-13/h3-6,9,11-12,16-17,27H,7-8,10H2,1-2H3,(H,22,24)(H,23,29)(H,25,28)(H,26,30)(H,31,32)/t16-,17-/m0/s1
InChI key:InChIKey=IHVRJTCVMKJNRP-IRXDYDNUSA-N
SMILES:[C@H](CC1=CN=CN1)(C(N[C@@H](CC(C)C)C(O)=O)=O)NC(CNC(=O)C2=CC=C(O)C=C2)=O
Synonyms:- <span class="text-smallcaps">L</smallcap>-Leucine, N-(4-hydroxybenzoyl)glycyl-<smallcap>L</span>-histidyl-
- <span class="text-smallcaps">L</smallcap>-Leucine, N-[N-[N-(4-hydroxybenzoyl)glycyl]-<smallcap>L</span>-histidyl]-
- N-(4-Hydroxybenzoyl)glycyl-<span class="text-smallcaps">L</smallcap>-histidyl-<smallcap>L</span>-leucine
- N-(4-hydroxybenzoyl)glycyl-L-histidyl-L-leucine
- p-Hydroxyhippuryl-<span class="text-smallcaps">L</smallcap>-histidyl-<smallcap>L</span>-leucine
- p-Hydroxyhippuryl-His-Leu-OH
- p-Hydroxyhippuryl-L-histidyl-L-leucine
- L-Leucine, N-[N-[N-(4-hydroxybenzoyl)glycyl]-L-histidyl]-
- L-Leucine, N-(4-hydroxybenzoyl)glycyl-L-histidyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
p-Hydroxyhippuryl-His-Leu-OH
CAS:Substrate for a simple, accurate, and reproducible colorimetric determination of angiotensin I-converting enzyme (ACE) activity.Formula:C21H27N5O6Purity:99.0%Color and Shape:WhitishMolecular weight:445.48p-Hydroxyhippuryl-His-Leu-OH
CAS:P-hydroxyhippuryl-His-Leu-OH is a natriuretic that has been shown to have beneficial effects on diabetic patients. It can be used to prevent and treat proliferative diabetic retinopathy, which is a complication of diabetes. P-hydroxyhippuryl-His-Leu-OH increases the glomerular filtration rate and decreases the ventricular mass index, which may be due to its ability to inhibit angiotensin II receptors in the brain. P-hydroxyhippuryl-His-Leu-OH also inhibits angiotensin converting enzyme, an enzyme that converts angiotensin I into angiotensin II. This inhibition leads to an increase in levels of atrial natriuretic peptide (ANP), brain natriuretic peptide (BNP), and the downstream effectors of these peptides, namely nitric oxide synthase and cyclooxygenaseFormula:C21H27N5O6Purity:Min. 95%Molecular weight:445.47 g/mol

