CymitQuimica logo

CAS 777-12-8

:

2-Amino-6-(trifluoromethyl)benzothiazole

Description:
2-Amino-6-(trifluoromethyl)benzothiazole is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. The presence of an amino group (-NH2) at the 2-position and a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the amino group, while the trifluoromethyl group enhances its lipophilicity and may impart unique electronic properties. It is often used in various applications, including pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The trifluoromethyl group can enhance biological activity and stability, making this compound of interest in medicinal chemistry. Additionally, its structure allows for potential interactions with biological targets, which can be explored in drug development. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity and environmental impact.
Formula:C8H5F3N2S
InChI:InChI=1S/C8H5F3N2S/c9-8(10,11)4-1-2-5-6(3-4)14-7(12)13-5/h1-3H,(H2,12,13)
InChI key:WEDYEBJLWMPPOK-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1C(F)(F)F)SC(=N2)N
Synonyms:
  • 2-Amino-6-(trifluoromethyl)-1,3-benzothiazole
  • 2-Amino-6-(trifluoromethyl)-1,3-benzothiazol
Found 7 products.