CAS 77784-22-6

9,10-dimethoxy-7-methyl-6,7-dihydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinoline

Description:

9,10-Dimethoxy-7-methyl-6,7-dihydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinoline is a complex organic compound characterized by its unique polycyclic structure, which includes both benzodioxole and quinoline moieties. This compound features two methoxy groups (-OCH3) and a methyl group (-CH3) that contribute to its chemical properties and potential biological activity. The presence of multiple aromatic rings suggests that it may exhibit significant stability and lipophilicity, which can influence its solubility and interaction with biological systems. The compound's structure may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound's CAS number, 77784-22-6, allows for its identification in chemical databases, facilitating research and development efforts. Overall, the characteristics of this compound make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₂₀H₁₉NO₄

InChI: InChI=1/C20H19NO4/c1-21-7-6-11-8-16-20(25-10-24-16)18-12-4-5-15(22-2)19(23-3)13(12)9-14(21)17(11)18/h4-5,8-9H,6-7,10H2,1-3H3

SMILES: CN1CCc2cc3c(c4c5ccc(c(c5cc1c24)OC)OC)OCO3

Synonyms:

• Dehydrocrebanine

5H-Benzo(g)-1,3-benzodioxolo(6,5,4-de)quinoline, 6,7-dihydro-9,10-dime thoxy-7-methyl-

CAS: 77784-22-6

Formula: C₂₀H₁₉NO₄

Molecular weight: 337.3692

Ref: IN-DA00G674

Dehydrocrebanine

CAS: 77784-22-6

Dehydrocrebanine: IC50 2.14 ug/mL against HL-60 leukemia cells; IC50 70 ng/mL for malaria.

Formula: C₂₀H₁₉NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 337.37

Ref: TM-TN3799

Dehydrocrebanine

CAS: 77784-22-6

Formula: C₂₀H₁₉NO₄

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 337.375

Ref: BP-SBP00178

Dehydrocrebanine

CAS: 77784-22-6

Dehydrocrebanine is an alkaloid, which is a naturally occurring chemical compound. It is derived primarily from certain plant species known for their rich alkaloid content, such as those in the Menispermaceae family. The compound exhibits a unique mode of action by interacting with specific receptors and ion channels in biological systems, potentially modulating various physiological processes.

Formula: C₂₀H₁₉NO₄

Purity: Min. 95%

Molecular weight: 337.4 g/mol

Ref: 3D-CDA78422