CAS 777857-86-0
:Carasinol B
Description:
Carasinol B, with the CAS number 777857-86-0, is a chemical compound that belongs to the class of natural products known as terpenoids. It is primarily derived from certain plant sources and exhibits a range of biological activities, which may include antimicrobial, anti-inflammatory, and antioxidant properties. The molecular structure of Carasinol B features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its unique chemical behavior and potential therapeutic applications. As a natural compound, it may also play a role in plant defense mechanisms. Research into Carasinol B is ongoing, focusing on its pharmacological effects and potential uses in medicine and agriculture. Its safety profile and environmental impact are also important considerations in its application. Overall, Carasinol B represents a fascinating area of study within the field of natural product chemistry, with implications for health and industry.
Formula:C56H44O13
InChI:InChI=1S/C56H44O13/c57-33-9-1-27(2-10-33)53-47(31-17-37(61)21-38(62)18-31)49-43(23-41(65)25-45(49)67-53)52-50-44(24-42(66)26-46(50)68-55(52)29-5-13-35(59)14-6-29)51-48(32-19-39(63)22-40(64)20-32)54(28-3-11-34(58)12-4-28)69-56(51)30-7-15-36(60)16-8-30/h1-26,47-48,51-66H/t47-,48+,51-,52+,53+,54-,55-,56+/m1/s1
InChI key:InChIKey=RAUCCLKIJHMTND-HFRYPGABSA-N
SMILES:OC1=CC([C@H]2C3=C(C=C(O)C=C3O[C@@H]2C4=CC=C(O)C=C4)[C@@H]5[C@@H]([C@H](O[C@H]5C6=CC=C(O)C=C6)C7=CC=C(O)C=C7)C8=CC(O)=CC(O)=C8)=C9[C@H]([C@@H](OC9=C1)C%10=CC=C(O)C=C%10)C%11=CC(O)=CC(O)=C%11
Synonyms:- [3,4′-Bibenzofuran]-6,6′-diol, 3′-(3,5-dihydroxyphenyl)-4-[(2R,3S,4R,5S)-4-(3,5-dihydroxyphenyl)tetrahydro-2,5-bis(4-hydroxyphenyl)-3-furanyl]-2,2′,3,3′-tetrahydro-2,2′-bis(4-hydroxyphenyl)-, (2R,2′S,3R,3′S)-rel-(+)-
- Carasinol B
- rel-(+)-(2R,2′S,3R,3′S)-3′-(3,5-Dihydroxyphenyl)-4-[(2R,3S,4R,5S)-4-(3,5-dihydroxyphenyl)tetrahydro-2,5-bis(4-hydroxyphenyl)-3-furanyl]-2,2′,3,3′-tetrahydro-2,2′-bis(4-hydroxyphenyl)[3,4′-bibenzofuran]-6,6′-diol
- [3,4′-Bibenzofuran]-6,6′-diol, 3′-(3,5-dihydroxyphenyl)-4-[(2R,3S,4R,5S)-4-(3,5-dihydroxyphenyl)tetrahydro-2,5-bis(4-hydroxyphenyl)-3-furanyl]-2,2′,3,3′-tetrahydro-2,2′-bis(4-hydroxyphenyl)-, (2S,2′R,3S,3′R)-rel-(+)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Carasinol B
CAS:Carasinol B is a natural product from Carex humilis Leyss.Formula:C56H44O13Purity:98%Color and Shape:SolidMolecular weight:924.955Carasinol B
CAS:Carasinol B is a bio-derived catalyst, which is synthesized through the fermentation of renewable agricultural by-products. This product functions by facilitating the transfer of electrons, effectively enhancing specific redox reactions crucial in various chemical processes. Its mode of action involves the selective acceleration of reaction rates without being consumed in the process, making it an efficient and sustainable option for industrial applications.
Formula:C56H44O13Purity:Min. 95%Molecular weight:924.90 g/mol

