CAS 777931-67-6

3-Bromo-2-chloro-6-methoxypyridine

Description:

3-Bromo-2-chloro-6-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and chlorine substituents at the 3 and 2 positions, respectively, along with a methoxy group at the 6 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. Its molecular structure suggests potential reactivity in nucleophilic substitution reactions, particularly due to the halogen substituents, which can serve as leaving groups. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. 3-Bromo-2-chloro-6-methoxypyridine may find applications in medicinal chemistry and material science, particularly in the synthesis of pharmaceuticals or agrochemicals, owing to the biological activity often associated with pyridine derivatives. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₆H₅BrClNO

InChI: InChI=1/C6H5BrClNO/c1-10-5-3-2-4(7)6(8)9-5/h2-3H,1H3

SMILES: COc1ccc(c(Cl)n1)Br

3-Bromo-2-chloro-6-methoxypyridine

CAS: 777931-67-6

Formula: C₆H₅BrClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.4670

Ref: IN-DA005RQQ

3-Bromo-2-chloro-6-methoxypyridine

CAS: 777931-67-6

3-Bromo-2-chloro-6-methoxypyridine

Purity: 97%

Molecular weight: 222.47g/mol

Ref: 54-OR345413

3-Bromo-2-chloro-6-methoxypyridine

CAS: 777931-67-6

Formula: C₆H₅BrClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.47

Ref: 10-F231805

3-Bromo-2-chloro-6-methoxypyridine

CAS: 777931-67-6

3-Bromo-2-chloro-6-methoxypyridine is an antitumor compound that has shown anti-angiogenic effects and anti-proliferative activities. It has been found to disrupt the cycle of tubulin polymerization and inhibit the proliferation of cells in a dose dependent manner. 3-Bromo-2-chloro-6-methoxypyridine binds to tubulin, which is the building block for microtubules, at the colchicine site. The binding of 3BCMP inhibits the assembly of tubulin into microtubules, resulting in a disruption of cytoskeletal function.

Formula: C₆H₅BrClNO

Purity: Min. 95%

Molecular weight: 222.47 g/mol

Ref: 3D-CGB93167