CAS 777931-67-6
:3-Bromo-2-chloro-6-methoxypyridine
Description:
3-Bromo-2-chloro-6-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and chlorine substituents at the 3 and 2 positions, respectively, along with a methoxy group at the 6 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. Its molecular structure suggests potential reactivity in nucleophilic substitution reactions, particularly due to the halogen substituents, which can serve as leaving groups. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. 3-Bromo-2-chloro-6-methoxypyridine may find applications in medicinal chemistry and material science, particularly in the synthesis of pharmaceuticals or agrochemicals, owing to the biological activity often associated with pyridine derivatives. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C6H5BrClNO
InChI:InChI=1/C6H5BrClNO/c1-10-5-3-2-4(7)6(8)9-5/h2-3H,1H3
SMILES:COc1ccc(c(Cl)n1)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-2-chloro-6-methoxypyridine
CAS:3-Bromo-2-chloro-6-methoxypyridineFormula:C6H5BrClNOPurity:97%Molecular weight:222.4673-Bromo-2-chloro-6-methoxypyridine
CAS:Formula:C6H5BrClNOPurity:98%Color and Shape:SolidMolecular weight:222.46703-Bromo-2-chloro-6-methoxypyridine
CAS:3-Bromo-2-chloro-6-methoxypyridineFormula:C6H5BrClNOPurity:98%Molecular weight:222.473-Bromo-2-chloro-6-methoxypyridine
CAS:Formula:C6H5BrClNOPurity:98%Color and Shape:SolidMolecular weight:222.473-Bromo-2-chloro-6-methoxypyridine
CAS:3-Bromo-2-chloro-6-methoxypyridine is an antitumor compound that has shown anti-angiogenic effects and anti-proliferative activities. It has been found to disrupt the cycle of tubulin polymerization and inhibit the proliferation of cells in a dose dependent manner. 3-Bromo-2-chloro-6-methoxypyridine binds to tubulin, which is the building block for microtubules, at the colchicine site. The binding of 3BCMP inhibits the assembly of tubulin into microtubules, resulting in a disruption of cytoskeletal function.Formula:C6H5BrClNOPurity:Min. 95%Molecular weight:222.47 g/mol




