CymitQuimica logo

CAS 778-10-9

:

N-(3-Hydroxyadamantan-1-yl)acetamide

Description:
N-(3-Hydroxyadamantan-1-yl)acetamide, with the CAS number 778-10-9, is a chemical compound that features a unique adamantane structure, which is a polycyclic hydrocarbon known for its stability and rigidity. This compound contains a hydroxyl group (-OH) at the 3-position of the adamantane framework, contributing to its solubility and reactivity. The acetamide functional group (-C(=O)NH2) attached to the nitrogen atom enhances its potential for hydrogen bonding, which can influence its biological activity and interactions. Typically, compounds with such structures may exhibit interesting pharmacological properties, including antiviral or analgesic effects, due to their ability to interact with biological targets. The presence of both the hydroxyl and acetamide groups suggests that this compound may participate in various chemical reactions, including esterification and amidation. Its stability, combined with the functional groups, makes it a subject of interest in medicinal chemistry and material science. However, specific applications and biological activities would require further investigation through empirical studies.
Formula:C12H19NO2
InChI:InChI=1S/C12H19NO2/c1-8(14)13-11-3-9-2-10(4-11)6-12(15,5-9)7-11/h9-10,15H,2-7H2,1H3,(H,13,14)
InChI key:QGQQCWHALQYFDK-UHFFFAOYSA-N
SMILES:CC(=NC12CC3CC(C1)CC(C3)(C2)O)O
Found 1 products.