CAS 77836-86-3
:(2E)-3-(4-{[(2E)-3,7-dimethylocta-2,6-dien-1-yl]oxy}-3,5-dimethoxyphenyl)prop-2-en-1-ol
Description:
The chemical substance with the name "(2E)-3-(4-{[(2E)-3,7-dimethylocta-2,6-dien-1-yl]oxy}-3,5-dimethoxyphenyl)prop-2-en-1-ol" and CAS number "77836-86-3" is a complex organic compound characterized by its multi-functional structure. It features a prop-2-en-1-ol moiety, indicating the presence of an allylic alcohol, which contributes to its reactivity and potential applications in organic synthesis. The compound also contains a phenyl ring substituted with methoxy groups, enhancing its solubility and possibly influencing its biological activity. The presence of a long aliphatic chain with a diene structure suggests potential for interactions in biological systems, possibly as a natural product or a synthetic derivative. Its stereochemistry, indicated by the (2E) configuration, plays a crucial role in determining its spatial arrangement and, consequently, its chemical behavior and interactions. Overall, this compound may exhibit interesting properties relevant to medicinal chemistry, materials science, or as a flavor and fragrance component, although specific biological or chemical activities would require further investigation.
Formula:C21H30O4
InChI:InChI=1/C21H30O4/c1-16(2)8-6-9-17(3)11-13-25-21-19(23-4)14-18(10-7-12-22)15-20(21)24-5/h7-8,10-11,14-15,22H,6,9,12-13H2,1-5H3/b10-7+,17-11+
Synonyms:- (E,E)-3-(4-((3,7-Dimethyl-2,6-octadienyl)oxy)-3,5-dimethoxyphenyl)-2-propen-1-ol
- 2-Propen-1-ol, 3-(4-((3,7-dimethyl-2,6-octadienyl)oxy)-3,5-dimethoxyphenyl)-, (E,E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Nelumol A
CAS:Nelumol A, and nelumal A show a potency comparable to the endogenous ligand, they may as a valuable potential novel lead compound in the search for FXR agonistsFormula:C21H30O4Purity:98%Color and Shape:SolidMolecular weight:346.46Nelumol A
CAS:Nelumol A is a synthetic fluorinated corticosteroid, which is derived from specific organic chemical synthesis. It functions primarily as an anti-inflammatory agent. By mimicking the action of glucocorticoids, it binds to intracellular glucocorticoid receptors, modulating the expression of glucocorticoid-responsive genes. This mechanism helps in reducing the expression of pro-inflammatory cytokines and adhesion molecules, thereby inhibiting inflammation.Formula:C21H30O4Purity:Min. 95%Molecular weight:346.5 g/mol


