CAS 779323-58-9
:5H-Pyrrolo[3,4-d]pyrimidine, 2,4-dichloro-6,7-dihydro-6-(phenylmethyl)-
Description:
5H-Pyrrolo[3,4-d]pyrimidine, 2,4-dichloro-6,7-dihydro-6-(phenylmethyl)-, identified by CAS number 779323-58-9, is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings. This compound features dichlorine substituents at the 2 and 4 positions, contributing to its unique reactivity and potential biological activity. The presence of a phenylmethyl group at the 6-position enhances its lipophilicity, which may influence its interaction with biological targets. The dihydro configuration indicates that the compound has a saturated bond in the ring system, which can affect its stability and reactivity. Such compounds are often studied for their potential pharmacological properties, including anticancer and antimicrobial activities. The structural complexity and specific substituents suggest that it may interact with various biological pathways, making it of interest in medicinal chemistry and drug development. Further research would be necessary to elucidate its specific properties and potential applications in therapeutic contexts.
Formula:C13H11Cl2N3
InChI:InChI=1S/C13H11Cl2N3/c14-12-10-7-18(6-9-4-2-1-3-5-9)8-11(10)16-13(15)17-12/h1-5H,6-8H2
InChI key:RZSMZEYQFCOUKN-UHFFFAOYSA-N
SMILES:C1C2=C(CN1CC3=CC=CC=C3)N=C(N=C2Cl)Cl
Synonyms:- 6-benzyl-2,4-dichloro-5H,6H,7H-pyrrolo[3,4-d]pyrimidine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
6-Benzyl-2,4-Dichloro-6,7-Dihydro-5H-Pyrrolo[3,4-D]Pyrimidine
CAS:Formula:C13H11Cl2N3Molecular weight:280.1525
