CymitQuimica logo

CAS 77978-74-6

:

Methyl 2,3-dihydro-4-(methoxycarbonyl)-5-methyl-2-oxo-1H-pyrrole-3-acetate

Description:
Methyl 2,3-dihydro-4-(methoxycarbonyl)-5-methyl-2-oxo-1H-pyrrole-3-acetate, with the CAS number 77978-74-6, is a chemical compound characterized by its pyrrole structure, which is a five-membered aromatic ring containing nitrogen. This compound features multiple functional groups, including a methoxycarbonyl group and an acetate moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl groups enhances its hydrophobic characteristics, while the carbonyl groups can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound's structure suggests it may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, its solubility properties are influenced by the functional groups present, which can affect its behavior in different solvents. Overall, this compound represents a versatile building block in organic chemistry, with potential applications in pharmaceuticals and agrochemicals.
Formula:C10H13NO5
InChI:InChI=1S/C10H13NO5/c1-5-8(10(14)16-3)6(9(13)11-5)4-7(12)15-2/h6H,4H2,1-3H3,(H,11,13)
InChI key:InChIKey=NPYQVGIAZWLWAH-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1C(C(OC)=O)=C(C)NC1=O
Synonyms:
  • Methyl 2,3-dihydro-4-(methoxycarbonyl)-5-methyl-2-oxo-1H-pyrrole-3-acetate
  • 1H-Pyrrole-3-acetic acid, 2,3-dihydro-4-(methoxycarbonyl)-5-methyl-2-oxo-, methyl ester
Found 2 products.