CymitQuimica logo

CAS 78071-37-1

:

3-Thiophenecarboxylic acid, 4-bromo-, methyl ester

Description:
3-Thiophenecarboxylic acid, 4-bromo-, methyl ester is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a carboxylic acid group and a bromine substituent at the 4-position of the thiophene ring contributes to its reactivity and potential applications in organic synthesis. As a methyl ester, it features a methoxy group (-OCH3) attached to the carboxylic acid, enhancing its solubility in organic solvents and influencing its chemical behavior. This compound is typically used in the synthesis of various pharmaceuticals and agrochemicals due to its unique electronic properties and ability to participate in further chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the bromine atom can serve as a useful handle for further functionalization, making it a versatile intermediate in synthetic organic chemistry. Overall, 3-thiophenecarboxylic acid, 4-bromo-, methyl ester exhibits characteristics that make it valuable in research and industrial applications.
Formula:C6H5BrO2S
InChI:InChI=1S/C6H5BrO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,1H3
InChI key:MNOCCIFVTOUKEG-UHFFFAOYSA-N
SMILES:COC(=O)C1=CSC=C1Br
Found 4 products.